C7H14N4O3 — CID 87991804
2-amino-N-[2-(hydroxyamino)-2-oxoethyl]pyrrolidine-1-carboxamide (PubChem CID 87991804) has the molecular formula C7H14N4O3 and a molecular weight of 202.21 g/mol. Its IUPAC name is 2-amino-N-[2-(hydroxyamino)-2-oxoethyl]pyrrolidine-1-carboxamide.
| Compound Name | 2-amino-N-[2-(hydroxyamino)-2-oxoethyl]pyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 87991804 |
| Molecular Formula | C7H14N4O3 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | 2-amino-N-[2-(hydroxyamino)-2-oxoethyl]pyrrolidine-1-carboxamide |
| SMILES | NC1CCCN1C(=O)NCC(=O)NO |
| InChI | InChI=1S/C7H14N4O3/c8-5-2-1-3-11(5)7(13)9-4-6(12)10-14/h5,14H,1-4,8H2,(H,9,13)(H,10,12) |
| InChIKey | HEEKVMNFCFCLLA-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 107.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|