C24H43NO6 — CID 87992606
2-amino-2-[2-[(Z)-octadec-9-enoxy]-2-oxoethyl]butanedioic acid (PubChem CID 87992606) has the molecular formula C24H43NO6 and a molecular weight of 441.61 g/mol. Its IUPAC name is 2-amino-2-[2-[(Z)-octadec-9-enoxy]-2-oxoethyl]butanedioic acid.
| Compound Name | 2-amino-2-[2-[(Z)-octadec-9-enoxy]-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 87992606 |
| Molecular Formula | C24H43NO6 |
| Molecular Weight | 441.61 g/mol |
| Exact Mass | 441.31 |
| IUPAC Name | 2-amino-2-[2-[(Z)-octadec-9-enoxy]-2-oxoethyl]butanedioic acid |
| SMILES | CCCCCCCC/C=C\CCCCCCCCOC(=O)CC(N)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C24H43NO6/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-31-22(28)20-24(25,23(29)30)19-21(26)27/h9-10H,2-8,11-20,25H2,1H3,(H,26,27)(H,29,30)/b10-9- |
| InChIKey | DARZRFSBJABFNU-KTKRTIGZSA-N |
| XLogP | 5.21 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.61 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|