About nitrooxy 4-pentylbenzenesulfonate
nitrooxy 4-pentylbenzenesulfonate (PubChem CID 87993589) has the molecular formula C11H15NO6S
and a molecular weight of 289.31 g/mol. Its IUPAC name is nitrooxy 4-pentylbenzenesulfonate.
Molecular Properties
| Compound Name | nitrooxy 4-pentylbenzenesulfonate |
| PubChem CID | 87993589 |
| Molecular Formula | C11H15NO6S |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | nitrooxy 4-pentylbenzenesulfonate |
| SMILES | CCCCCc1ccc(S(=O)(=O)OO[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H15NO6S/c1-2-3-4-5-10-6-8-11(9-7-10)19(15,16)18-17-12(13)14/h6-9H,2-5H2,1H3 |
| InChIKey | FXNDAHVFLOJUBA-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze nitrooxy 4-pentylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitrooxy 4-pentylbenzenesulfonate?
The IUPAC name of nitrooxy 4-pentylbenzenesulfonate (CID 87993589) is nitrooxy 4-pentylbenzenesulfonate.
What is the SMILES notation for nitrooxy 4-pentylbenzenesulfonate?
The canonical SMILES for nitrooxy 4-pentylbenzenesulfonate is CCCCCc1ccc(S(=O)(=O)OO[N+](=O)[O-])cc1.
What is the InChIKey of nitrooxy 4-pentylbenzenesulfonate?
The InChIKey is FXNDAHVFLOJUBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO6S/c1-2-3-4-5-10-6-8-11(9-7-10)19(15,16)18-17-12(13)14/h6-9H,2-5H2,1H3.
What are the key properties of nitrooxy 4-pentylbenzenesulfonate?
nitrooxy 4-pentylbenzenesulfonate has a molecular weight of 289.31 g/mol, XLogP of 2.25, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for nitrooxy 4-pentylbenzenesulfonate is sourced from PubChem (CID 87993589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).