C23H20ClN3O2 — CID 87994144
4-(chloromethyl)-N-[3-(cyanomethylamino)-2-naphthalen-2-yl-3-oxopropyl]benzamide (PubChem CID 87994144) has the molecular formula C23H20ClN3O2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 4-(chloromethyl)-N-[3-(cyanomethylamino)-2-naphthalen-2-yl-3-oxopropyl]benzamide.
| Compound Name | 4-(chloromethyl)-N-[3-(cyanomethylamino)-2-naphthalen-2-yl-3-oxopropyl]benzamide |
|---|---|
| PubChem CID | 87994144 |
| Molecular Formula | C23H20ClN3O2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 4-(chloromethyl)-N-[3-(cyanomethylamino)-2-naphthalen-2-yl-3-oxopropyl]benzamide |
| SMILES | N#CCNC(=O)C(CNC(=O)c1ccc(CCl)cc1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H20ClN3O2/c24-14-16-5-7-18(8-6-16)22(28)27-15-21(23(29)26-12-11-25)20-10-9-17-3-1-2-4-19(17)13-20/h1-10,13,21H,12,14-15H2,(H,26,29)(H,27,28) |
| InChIKey | CXTODCCDCFUXED-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|