C14H28O2 — CID 87994195
(E)-2,11-dimethyldodec-6-ene-2,11-diol (PubChem CID 87994195) has the molecular formula C14H28O2 and a molecular weight of 228.38 g/mol. Its IUPAC name is (E)-2,11-dimethyldodec-6-ene-2,11-diol.
| Compound Name | (E)-2,11-dimethyldodec-6-ene-2,11-diol |
|---|---|
| PubChem CID | 87994195 |
| Molecular Formula | C14H28O2 |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.21 |
| IUPAC Name | (E)-2,11-dimethyldodec-6-ene-2,11-diol |
| SMILES | CC(C)(O)CCC/C=C/CCCC(C)(C)O |
| InChI | InChI=1S/C14H28O2/c1-13(2,15)11-9-7-5-6-8-10-12-14(3,4)16/h5-6,15-16H,7-12H2,1-4H3/b6-5+ |
| InChIKey | QQEGSFVMNRXYBZ-AATRIKPKSA-N |
| XLogP | 3.42 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|