C17H30O — CID 143822198
ethane;(6E,8E)-8-ethenyl-2,10-dimethylundeca-6,8,10-trien-2-ol (PubChem CID 143822198) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is ethane;(6E,8E)-8-ethenyl-2,10-dimethylundeca-6,8,10-trien-2-ol.
| Compound Name | ethane;(6E,8E)-8-ethenyl-2,10-dimethylundeca-6,8,10-trien-2-ol |
|---|---|
| PubChem CID | 143822198 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | ethane;(6E,8E)-8-ethenyl-2,10-dimethylundeca-6,8,10-trien-2-ol |
| SMILES | C=CC(/C=C/CCCC(C)(C)O)=C\C(=C)C.CC |
| InChI | InChI=1S/C15H24O.C2H6/c1-6-14(12-13(2)3)10-8-7-9-11-15(4,5)16;1-2/h6,8,10,12,16H,1-2,7,9,11H2,3-5H3;1-2H3/b10-8+,14-12+; |
| InChIKey | KLWQAKNWZZARND-DAXLARRDSA-N |
| XLogP | 5.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|