C13H30N2O7P+ — CID 87995106
2-[[[(1R)-1-carboxy-2-hydroxyethyl]-pentylamino]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium (PubChem CID 87995106) has the molecular formula C13H30N2O7P+ and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-[[[(1R)-1-carboxy-2-hydroxyethyl]-pentylamino]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium.
| Compound Name | 2-[[[(1R)-1-carboxy-2-hydroxyethyl]-pentylamino]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 87995106 |
| Molecular Formula | C13H30N2O7P+ |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | 2-[[[(1R)-1-carboxy-2-hydroxyethyl]-pentylamino]oxy-hydroxyphosphoryl]oxyethyl-trimethylazanium |
| SMILES | CCCCCN(OP(=O)(O)OCC[N+](C)(C)C)[C@H](CO)C(=O)O |
| InChI | InChI=1S/C13H29N2O7P/c1-5-6-7-8-14(12(11-16)13(17)18)22-23(19,20)21-10-9-15(2,3)4/h12,16H,5-11H2,1-4H3,(H-,17,18,19,20)/p+1/t12-/m1/s1 |
| InChIKey | GQFHOAFISMSPSQ-GFCCVEGCSA-O |
| XLogP | 0.68 |
| TPSA | 116.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|