C25H30F9N5O4 — CID 87995758
bis(2,2,2-trifluoroacetic acid);4-N,4-N,5-trimethyl-2-N-[4-[[3-(trifluoromethyl)phenyl]methylamino]cyclohexyl]pyrimidine-2,4-diamine (PubChem CID 87995758) has the molecular formula C25H30F9N5O4 and a molecular weight of 635.53 g/mol. Its IUPAC name is bis(2,2,2-trifluoroacetic acid);4-N,4-N,5-trimethyl-2-N-[4-[[3-(trifluoromethyl)phenyl]methylamino]cyclohexyl]pyrimidine-2,4-diamine.
| Compound Name | bis(2,2,2-trifluoroacetic acid);4-N,4-N,5-trimethyl-2-N-[4-[[3-(trifluoromethyl)phenyl]methylamino]cyclohexyl]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 87995758 |
| Molecular Formula | C25H30F9N5O4 |
| Molecular Weight | 635.53 g/mol |
| Exact Mass | 635.22 |
| IUPAC Name | bis(2,2,2-trifluoroacetic acid);4-N,4-N,5-trimethyl-2-N-[4-[[3-(trifluoromethyl)phenyl]methylamino]cyclohexyl]pyrimidine-2,4-diamine |
| SMILES | Cc1cnc(NC2CCC(NCc3cccc(C(F)(F)F)c3)CC2)nc1N(C)C.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C21H28F3N5.2C2HF3O2/c1-14-12-26-20(28-19(14)29(2)3)27-18-9-7-17(8-10-18)25-13-15-5-4-6-16(11-15)21(22,23)24;2*3-2(4,5)1(6)7/h4-6,11-12,17-18,25H,7-10,13H2,1-3H3,(H,26,27,28);2*(H,6,7) |
| InChIKey | POWMODBFQRKKJB-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.53 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |