C23H27F6N5O2 — CID 87995828
N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide (PubChem CID 87995828) has the molecular formula C23H27F6N5O2 and a molecular weight of 519.49 g/mol. Its IUPAC name is N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide.
| Compound Name | N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide |
|---|---|
| PubChem CID | 87995828 |
| Molecular Formula | C23H27F6N5O2 |
| Molecular Weight | 519.49 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | N-[4-[[4-(dimethylamino)-5-methylpyrimidin-2-yl]amino]cyclohexyl]-4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)benzamide |
| SMILES | Cc1cnc(NC2CCC(NC(=O)c3ccc(C(O)(C(F)(F)F)C(F)(F)F)cc3)CC2)nc1N(C)C |
| InChI | InChI=1S/C23H27F6N5O2/c1-13-12-30-20(33-18(13)34(2)3)32-17-10-8-16(9-11-17)31-19(35)14-4-6-15(7-5-14)21(36,22(24,25)26)23(27,28)29/h4-7,12,16-17,36H,8-11H2,1-3H3,(H,31,35)(H,30,32,33) |
| InChIKey | AIZIHNMQCLBYTO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.49 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |