C25H25OSiZr- — CID 87996057
2-methyl-3H-cyclopenta[a]naphthalen-3-ide;4,8,8,9-tetramethyl-3-oxa-8-silatricyclo[5.1.1.02,6]nona-1(9),2(6),4-triene;zirconium (PubChem CID 87996057) has the molecular formula C25H25OSiZr- and a molecular weight of 460.78 g/mol. Its IUPAC name is 2-methyl-3H-cyclopenta[a]naphthalen-3-ide;4,8,8,9-tetramethyl-3-oxa-8-silatricyclo[5.1.1.02,6]nona-1(9),2(6),4-triene;zirconium.
| Compound Name | 2-methyl-3H-cyclopenta[a]naphthalen-3-ide;4,8,8,9-tetramethyl-3-oxa-8-silatricyclo[5.1.1.02,6]nona-1(9),2(6),4-triene;zirconium |
|---|---|
| PubChem CID | 87996057 |
| Molecular Formula | C25H25OSiZr- |
| Molecular Weight | 460.78 g/mol |
| Exact Mass | 459.07 |
| IUPAC Name | 2-methyl-3H-cyclopenta[a]naphthalen-3-ide;4,8,8,9-tetramethyl-3-oxa-8-silatricyclo[5.1.1.02,6]nona-1(9),2(6),4-triene;zirconium |
| SMILES | CC1=C2c3oc(C)cc3C1[Si]2(C)C.Cc1cc2c(ccc3ccccc32)[cH-]1.[Zr] |
| InChI | InChI=1S/C14H11.C11H14OSi.Zr/c1-10-8-12-7-6-11-4-2-3-5-13(11)14(12)9-10;1-6-5-8-9(12-6)11-7(2)10(8)13(11,3)4;/h2-9H,1H3;5,10H,1-4H3;/q-1;; |
| InChIKey | NQNDZFPFCCVSRI-UHFFFAOYSA-N |
| XLogP | 7.28 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.78 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|