About 1-chloropropan-2-yl ethaneperoxoate
1-chloropropan-2-yl ethaneperoxoate (PubChem CID 87996667) has the molecular formula C5H9ClO3
and a molecular weight of 152.58 g/mol. Its IUPAC name is 1-chloropropan-2-yl ethaneperoxoate.
Molecular Properties
| Compound Name | 1-chloropropan-2-yl ethaneperoxoate |
| PubChem CID | 87996667 |
| Molecular Formula | C5H9ClO3 |
| Molecular Weight | 152.58 g/mol |
| Exact Mass | 152.02 |
| IUPAC Name | 1-chloropropan-2-yl ethaneperoxoate |
| SMILES | CC(=O)OOC(C)CCl |
| InChI | InChI=1S/C5H9ClO3/c1-4(3-6)8-9-5(2)7/h4H,3H2,1-2H3 |
| InChIKey | DPBBGTHOEHEMGJ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.58 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropropan-2-yl ethaneperoxoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropropan-2-yl ethaneperoxoate?
The IUPAC name of 1-chloropropan-2-yl ethaneperoxoate (CID 87996667) is 1-chloropropan-2-yl ethaneperoxoate.
What is the SMILES notation for 1-chloropropan-2-yl ethaneperoxoate?
The canonical SMILES for 1-chloropropan-2-yl ethaneperoxoate is CC(=O)OOC(C)CCl.
What is the InChIKey of 1-chloropropan-2-yl ethaneperoxoate?
The InChIKey is DPBBGTHOEHEMGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO3/c1-4(3-6)8-9-5(2)7/h4H,3H2,1-2H3.
What are the key properties of 1-chloropropan-2-yl ethaneperoxoate?
1-chloropropan-2-yl ethaneperoxoate has a molecular weight of 152.58 g/mol, XLogP of 1.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropropan-2-yl ethaneperoxoate is sourced from PubChem (CID 87996667), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).