C22H19BrF2N2O4 — CID 87997656
3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxo-1H-pyridin-3-yl]-N-hydroxy-N,4-dimethylbenzamide (PubChem CID 87997656) has the molecular formula C22H19BrF2N2O4 and a molecular weight of 493.30 g/mol. Its IUPAC name is 3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxo-1H-pyridin-3-yl]-N-hydroxy-N,4-dimethylbenzamide.
| Compound Name | 3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxo-1H-pyridin-3-yl]-N-hydroxy-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 87997656 |
| Molecular Formula | C22H19BrF2N2O4 |
| Molecular Weight | 493.30 g/mol |
| Exact Mass | 492.05 |
| IUPAC Name | 3-[5-bromo-4-[(2,4-difluorophenyl)methoxy]-2-methyl-6-oxo-1H-pyridin-3-yl]-N-hydroxy-N,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)N(C)O)cc1-c1c(C)[nH]c(=O)c(Br)c1OCc1ccc(F)cc1F |
| InChI | InChI=1S/C22H19BrF2N2O4/c1-11-4-5-13(22(29)27(3)30)8-16(11)18-12(2)26-21(28)19(23)20(18)31-10-14-6-7-15(24)9-17(14)25/h4-9,30H,10H2,1-3H3,(H,26,28) |
| InChIKey | KAESZSYBABHCQE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 82.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.30 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|