C23H27ClN4O2 — CID 8800095
N-(2-chlorophenyl)-2-[4-[2-oxo-2-(N-prop-2-enylanilino)ethyl]piperazin-1-yl]acetamide (PubChem CID 8800095) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[4-[2-oxo-2-(N-prop-2-enylanilino)ethyl]piperazin-1-yl]acetamide.
| Compound Name | N-(2-chlorophenyl)-2-[4-[2-oxo-2-(N-prop-2-enylanilino)ethyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 8800095 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | N-(2-chlorophenyl)-2-[4-[2-oxo-2-(N-prop-2-enylanilino)ethyl]piperazin-1-yl]acetamide |
| SMILES | C=CCN(C(=O)CN1CCN(CC(=O)Nc2ccccc2Cl)CC1)c1ccccc1 |
| InChI | InChI=1S/C23H27ClN4O2/c1-2-12-28(19-8-4-3-5-9-19)23(30)18-27-15-13-26(14-16-27)17-22(29)25-21-11-7-6-10-20(21)24/h2-11H,1,12-18H2,(H,25,29) |
| InChIKey | DJIJCUFAWVWHGZ-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|