C21H26N3O2S+ — CID 8803923
1,3-benzothiazol-2-ylmethyl-[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl]-methylazanium (PubChem CID 8803923) has the molecular formula C21H26N3O2S+ and a molecular weight of 384.53 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl-[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl]-methylazanium.
| Compound Name | 1,3-benzothiazol-2-ylmethyl-[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8803923 |
| Molecular Formula | C21H26N3O2S+ |
| Molecular Weight | 384.53 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl-[2-[2-(2,4-dimethylphenoxy)ethylamino]-2-oxoethyl]-methylazanium |
| SMILES | Cc1ccc(OCCNC(=O)C[NH+](C)Cc2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C21H25N3O2S/c1-15-8-9-18(16(2)12-15)26-11-10-22-20(25)13-24(3)14-21-23-17-6-4-5-7-19(17)27-21/h4-9,12H,10-11,13-14H2,1-3H3,(H,22,25)/p+1 |
| InChIKey | LHJGGPWSYWYORS-UHFFFAOYSA-O |
| XLogP | 2.12 |
| TPSA | 55.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.53 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|