C20H24N3O3S+ — CID 8803605
1,3-benzothiazol-2-ylmethyl-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl]-methylazanium (PubChem CID 8803605) has the molecular formula C20H24N3O3S+ and a molecular weight of 386.50 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylmethyl-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl]-methylazanium.
| Compound Name | 1,3-benzothiazol-2-ylmethyl-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl]-methylazanium |
|---|---|
| PubChem CID | 8803605 |
| Molecular Formula | C20H24N3O3S+ |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 1,3-benzothiazol-2-ylmethyl-[2-[2-(2-methoxyphenoxy)ethylamino]-2-oxoethyl]-methylazanium |
| SMILES | COc1ccccc1OCCNC(=O)C[NH+](C)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H23N3O3S/c1-23(14-20-22-15-7-3-6-10-18(15)27-20)13-19(24)21-11-12-26-17-9-5-4-8-16(17)25-2/h3-10H,11-14H2,1-2H3,(H,21,24)/p+1 |
| InChIKey | SWLYWYOKXHMONM-UHFFFAOYSA-O |
| XLogP | 1.51 |
| TPSA | 64.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|