C20H15Cl2NO4 — CID 8806229
[2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate (PubChem CID 8806229) has the molecular formula C20H15Cl2NO4 and a molecular weight of 404.25 g/mol. Its IUPAC name is [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate.
| Compound Name | [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 8806229 |
| Molecular Formula | C20H15Cl2NO4 |
| Molecular Weight | 404.25 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(3,4-dichlorophenyl)prop-2-enoate |
| SMILES | C[C@@H]1C(=O)Nc2ccc(C(=O)COC(=O)/C=C/c3ccc(Cl)c(Cl)c3)cc21 |
| InChI | InChI=1S/C20H15Cl2NO4/c1-11-14-9-13(4-6-17(14)23-20(11)26)18(24)10-27-19(25)7-3-12-2-5-15(21)16(22)8-12/h2-9,11H,10H2,1H3,(H,23,26)/b7-3+/t11-/m0/s1 |
| InChIKey | FEQMCKZPCNYIJZ-KTROKBFUSA-N |
| XLogP | 4.49 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.25 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|