C20H16ClNO4 — CID 9285944
[2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate (PubChem CID 9285944) has the molecular formula C20H16ClNO4 and a molecular weight of 369.80 g/mol. Its IUPAC name is [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate.
| Compound Name | [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 9285944 |
| Molecular Formula | C20H16ClNO4 |
| Molecular Weight | 369.80 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | [2-[(3S)-3-methyl-2-oxo-1,3-dihydroindol-5-yl]-2-oxoethyl] (E)-3-(2-chlorophenyl)prop-2-enoate |
| SMILES | C[C@@H]1C(=O)Nc2ccc(C(=O)COC(=O)/C=C/c3ccccc3Cl)cc21 |
| InChI | InChI=1S/C20H16ClNO4/c1-12-15-10-14(6-8-17(15)22-20(12)25)18(23)11-26-19(24)9-7-13-4-2-3-5-16(13)21/h2-10,12H,11H2,1H3,(H,22,25)/b9-7+/t12-/m0/s1 |
| InChIKey | KKBATWIVDLSFIT-CRALRDPISA-N |
| XLogP | 3.83 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.80 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|