C18H26N4O2S — CID 8807084
2-[[(3R)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]-N-[(2R)-heptan-2-yl]acetamide (PubChem CID 8807084) has the molecular formula C18H26N4O2S and a molecular weight of 362.50 g/mol. Its IUPAC name is 2-[[(3R)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]-N-[(2R)-heptan-2-yl]acetamide.
| Compound Name | 2-[[(3R)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]-N-[(2R)-heptan-2-yl]acetamide |
|---|---|
| PubChem CID | 8807084 |
| Molecular Formula | C18H26N4O2S |
| Molecular Weight | 362.50 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 2-[[(3R)-3,5-dicyano-4,4-dimethyl-2-oxo-1,3-dihydropyridin-6-yl]sulfanyl]-N-[(2R)-heptan-2-yl]acetamide |
| SMILES | CCCCC[C@@H](C)NC(=O)CSC1=C(C#N)C(C)(C)[C@H](C#N)C(=O)N1 |
| InChI | InChI=1S/C18H26N4O2S/c1-5-6-7-8-12(2)21-15(23)11-25-17-14(10-20)18(3,4)13(9-19)16(24)22-17/h12-13H,5-8,11H2,1-4H3,(H,21,23)(H,22,24)/t12-,13-/m1/s1 |
| InChIKey | FEFFSQYOHLPIII-CHWSQXEVSA-N |
| XLogP | 2.84 |
| TPSA | 105.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.50 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|