C20H23NO5S — CID 8807970
methyl 3-methoxy-4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-2-oxoethoxy]benzoate (PubChem CID 8807970) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is methyl 3-methoxy-4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-2-oxoethoxy]benzoate.
| Compound Name | methyl 3-methoxy-4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 8807970 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | methyl 3-methoxy-4-[2-[methyl-[(4-methylsulfanylphenyl)methyl]amino]-2-oxoethoxy]benzoate |
| SMILES | COC(=O)c1ccc(OCC(=O)N(C)Cc2ccc(SC)cc2)c(OC)c1 |
| InChI | InChI=1S/C20H23NO5S/c1-21(12-14-5-8-16(27-4)9-6-14)19(22)13-26-17-10-7-15(20(23)25-3)11-18(17)24-2/h5-11H,12-13H2,1-4H3 |
| InChIKey | AKNHVQLNBJNEQQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |