C23H27N5O3 — CID 8810130
2-[2-[[[2-(2-methylanilino)-2-oxoethyl]-propylamino]methyl]-4-oxoquinazolin-3-yl]acetamide (PubChem CID 8810130) has the molecular formula C23H27N5O3 and a molecular weight of 421.50 g/mol. Its IUPAC name is 2-[2-[[[2-(2-methylanilino)-2-oxoethyl]-propylamino]methyl]-4-oxoquinazolin-3-yl]acetamide.
| Compound Name | 2-[2-[[[2-(2-methylanilino)-2-oxoethyl]-propylamino]methyl]-4-oxoquinazolin-3-yl]acetamide |
|---|---|
| PubChem CID | 8810130 |
| Molecular Formula | C23H27N5O3 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[2-[[[2-(2-methylanilino)-2-oxoethyl]-propylamino]methyl]-4-oxoquinazolin-3-yl]acetamide |
| SMILES | CCCN(CC(=O)Nc1ccccc1C)Cc1nc2ccccc2c(=O)n1CC(N)=O |
| InChI | InChI=1S/C23H27N5O3/c1-3-12-27(15-22(30)26-18-10-6-4-8-16(18)2)14-21-25-19-11-7-5-9-17(19)23(31)28(21)13-20(24)29/h4-11H,3,12-15H2,1-2H3,(H2,24,29)(H,26,30) |
| InChIKey | JMLSEXKXZHLWBR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 110.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |