C20H25N3O4S — CID 8811924
ethyl (E)-2-cyano-3-[[3-[[(2R)-oxolan-2-yl]methylcarbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]prop-2-enoate (PubChem CID 8811924) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is ethyl (E)-2-cyano-3-[[3-[[(2R)-oxolan-2-yl]methylcarbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]prop-2-enoate.
| Compound Name | ethyl (E)-2-cyano-3-[[3-[[(2R)-oxolan-2-yl]methylcarbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]prop-2-enoate |
|---|---|
| PubChem CID | 8811924 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | ethyl (E)-2-cyano-3-[[3-[[(2R)-oxolan-2-yl]methylcarbamoyl]-4,5,6,7-tetrahydro-1-benzothiophen-2-yl]amino]prop-2-enoate |
| SMILES | CCOC(=O)/C(C#N)=C/Nc1sc2c(c1C(=O)NC[C@H]1CCCO1)CCCC2 |
| InChI | InChI=1S/C20H25N3O4S/c1-2-26-20(25)13(10-21)11-23-19-17(15-7-3-4-8-16(15)28-19)18(24)22-12-14-6-5-9-27-14/h11,14,23H,2-9,12H2,1H3,(H,22,24)/b13-11+/t14-/m1/s1 |
| InChIKey | NLFLWJPCQDCCPG-YPDDLIOESA-N |
| XLogP | 2.92 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|