C18H23NO6S — CID 46371007
diethyl 2-[[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]methylidene]propanedioate (PubChem CID 46371007) has the molecular formula C18H23NO6S and a molecular weight of 381.45 g/mol. Its IUPAC name is diethyl 2-[[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]methylidene]propanedioate.
| Compound Name | diethyl 2-[[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]methylidene]propanedioate |
|---|---|
| PubChem CID | 46371007 |
| Molecular Formula | C18H23NO6S |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | diethyl 2-[[(3-methoxycarbonyl-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=CNc1sc2c(c1C(=O)OC)CCCC2)C(=O)OCC |
| InChI | InChI=1S/C18H23NO6S/c1-4-24-16(20)12(17(21)25-5-2)10-19-15-14(18(22)23-3)11-8-6-7-9-13(11)26-15/h10,19H,4-9H2,1-3H3 |
| InChIKey | CXPKYNWBEFTUDY-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|