C18H22N4O7S — CID 135635908
methyl 2-[[2-[(2E)-2-[(3E)-4-ethoxy-3-hydroxyimino-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 135635908) has the molecular formula C18H22N4O7S and a molecular weight of 438.46 g/mol. Its IUPAC name is methyl 2-[[2-[(2E)-2-[(3E)-4-ethoxy-3-hydroxyimino-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 2-[[2-[(2E)-2-[(3E)-4-ethoxy-3-hydroxyimino-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 135635908 |
| Molecular Formula | C18H22N4O7S |
| Molecular Weight | 438.46 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | methyl 2-[[2-[(2E)-2-[(3E)-4-ethoxy-3-hydroxyimino-4-oxobutan-2-ylidene]hydrazinyl]-2-oxoacetyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)C(=N/O)/C(C)=N/NC(=O)C(=O)Nc1sc2c(c1C(=O)OC)CCCC2 |
| InChI | InChI=1S/C18H22N4O7S/c1-4-29-18(26)13(22-27)9(2)20-21-15(24)14(23)19-16-12(17(25)28-3)10-7-5-6-8-11(10)30-16/h27H,4-8H2,1-3H3,(H,19,23)(H,21,24)/b20-9+,22-13+ |
| InChIKey | KPZCSIYFGPAZGF-GNRRCFQUSA-N |
| XLogP | 1.24 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.46 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|