C16H13FN4OS — CID 881215
1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)urea (PubChem CID 881215) has the molecular formula C16H13FN4OS and a molecular weight of 328.37 g/mol. Its IUPAC name is 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)urea.
| Compound Name | 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)urea |
|---|---|
| PubChem CID | 881215 |
| Molecular Formula | C16H13FN4OS |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.08 |
| IUPAC Name | 1-(5-benzyl-1,3,4-thiadiazol-2-yl)-3-(2-fluorophenyl)urea |
| SMILES | O=C(Nc1nnc(Cc2ccccc2)s1)Nc1ccccc1F |
| InChI | InChI=1S/C16H13FN4OS/c17-12-8-4-5-9-13(12)18-15(22)19-16-21-20-14(23-16)10-11-6-2-1-3-7-11/h1-9H,10H2,(H2,18,19,21,22) |
| InChIKey | SFYKRJXKXJVCRD-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |