C18H20N4S — CID 8812532
(2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8812532) has the molecular formula C18H20N4S and a molecular weight of 324.45 g/mol. Its IUPAC name is (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8812532 |
| Molecular Formula | C18H20N4S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (2S)-3-[(3S)-1-benzylpyrrolidin-3-yl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | Cc1csc([C@H](C#N)/C=N/[C@H]2CCN(Cc3ccccc3)C2)n1 |
| InChI | InChI=1S/C18H20N4S/c1-14-13-23-18(21-14)16(9-19)10-20-17-7-8-22(12-17)11-15-5-3-2-4-6-15/h2-6,10,13,16-17H,7-8,11-12H2,1H3/b20-10+/t16-,17+/m1/s1 |
| InChIKey | KJLGRTOEHVWCLS-PKKHPNISSA-N |
| XLogP | 3.40 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|