C19H16N3O5S- — CID 8814664
4-[(E)-(5-ethyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-10-ylidene)methyl]-2-methoxy-6-nitrophenolate (PubChem CID 8814664) has the molecular formula C19H16N3O5S- and a molecular weight of 398.42 g/mol. Its IUPAC name is 4-[(E)-(5-ethyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-10-ylidene)methyl]-2-methoxy-6-nitrophenolate.
| Compound Name | 4-[(E)-(5-ethyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-10-ylidene)methyl]-2-methoxy-6-nitrophenolate |
|---|---|
| PubChem CID | 8814664 |
| Molecular Formula | C19H16N3O5S- |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 4-[(E)-(5-ethyl-2-oxo-6-thia-1,8-diazatricyclo[7.3.0.03,7]dodeca-3(7),4,8-trien-10-ylidene)methyl]-2-methoxy-6-nitrophenolate |
| SMILES | CCc1cc2c(=O)n3c(nc2s1)/C(=C/c1cc(OC)c([O-])c([N+](=O)[O-])c1)CC3 |
| InChI | InChI=1S/C19H17N3O5S/c1-3-12-9-13-18(28-12)20-17-11(4-5-21(17)19(13)24)6-10-7-14(22(25)26)16(23)15(8-10)27-2/h6-9,23H,3-5H2,1-2H3/p-1/b11-6+ |
| InChIKey | JVPNWAHAGMSVRC-IZZDOVSWSA-M |
| XLogP | 2.96 |
| TPSA | 110.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|