C17H19N3O2S — CID 8821716
(2R)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8821716) has the molecular formula C17H19N3O2S and a molecular weight of 329.43 g/mol. Its IUPAC name is (2R)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | (2R)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8821716 |
| Molecular Formula | C17H19N3O2S |
| Molecular Weight | 329.43 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | (2R)-3-[(1S)-1-(2,5-dimethoxyphenyl)ethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | COc1ccc(OC)c([C@H](C)/N=C/[C@H](C#N)c2nc(C)cs2)c1 |
| InChI | InChI=1S/C17H19N3O2S/c1-11-10-23-17(20-11)13(8-18)9-19-12(2)15-7-14(21-3)5-6-16(15)22-4/h5-7,9-10,12-13H,1-4H3/b19-9+/t12-,13-/m0/s1 |
| InChIKey | VBAHVHWOOPPDII-YWYYJGQGSA-N |
| XLogP | 3.91 |
| TPSA | 67.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|