C19H17N3S2 — CID 8821699
3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8821699) has the molecular formula C19H17N3S2 and a molecular weight of 351.50 g/mol. Its IUPAC name is 3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | 3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8821699 |
| Molecular Formula | C19H17N3S2 |
| Molecular Weight | 351.50 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 3-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | Cc1ccc([C@@H](/N=C/C(C#N)c2nc(C)cs2)c2cccs2)cc1 |
| InChI | InChI=1S/C19H17N3S2/c1-13-5-7-15(8-6-13)18(17-4-3-9-23-17)21-11-16(10-20)19-22-14(2)12-24-19/h3-9,11-12,16,18H,1-2H3/b21-11+/t16?,18-/m1/s1 |
| InChIKey | GXXWECDPJOLJRF-IVODYXHKSA-N |
| XLogP | 5.29 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.50 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|