C19H24N4S — CID 8812706
3-[(2R)-2-(diethylamino)-2-phenylethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8812706) has the molecular formula C19H24N4S and a molecular weight of 340.50 g/mol. Its IUPAC name is 3-[(2R)-2-(diethylamino)-2-phenylethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | 3-[(2R)-2-(diethylamino)-2-phenylethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8812706 |
| Molecular Formula | C19H24N4S |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | 3-[(2R)-2-(diethylamino)-2-phenylethyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | CCN(CC)[C@@H](C/N=C/C(C#N)c1nc(C)cs1)c1ccccc1 |
| InChI | InChI=1S/C19H24N4S/c1-4-23(5-2)18(16-9-7-6-8-10-16)13-21-12-17(11-20)19-22-15(3)14-24-19/h6-10,12,14,17-18H,4-5,13H2,1-3H3/b21-12+/t17?,18-/m0/s1 |
| InChIKey | YAXPWACBWOXHSD-UVGWDOLBSA-N |
| XLogP | 4.21 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|