C18H27N3S — CID 8821799
3-[4-(2-methylbutan-2-yl)cyclohexyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8821799) has the molecular formula C18H27N3S and a molecular weight of 317.50 g/mol. Its IUPAC name is 3-[4-(2-methylbutan-2-yl)cyclohexyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | 3-[4-(2-methylbutan-2-yl)cyclohexyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8821799 |
| Molecular Formula | C18H27N3S |
| Molecular Weight | 317.50 g/mol |
| Exact Mass | 317.19 |
| IUPAC Name | 3-[4-(2-methylbutan-2-yl)cyclohexyl]imino-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | CCC(C)(C)C1CCC(/N=C/C(C#N)c2nc(C)cs2)CC1 |
| InChI | InChI=1S/C18H27N3S/c1-5-18(3,4)15-6-8-16(9-7-15)20-11-14(10-19)17-21-13(2)12-22-17/h11-12,14-16H,5-9H2,1-4H3/b20-11+ |
| InChIKey | VHRYJHFYFJAPMF-RGVLZGJSSA-N |
| XLogP | 5.12 |
| TPSA | 49.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.50 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|