C14H20N4S — CID 8811959
3-[[(2R)-1-ethylpyrrolidin-2-yl]methylimino]-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile (PubChem CID 8811959) has the molecular formula C14H20N4S and a molecular weight of 276.41 g/mol. Its IUPAC name is 3-[[(2R)-1-ethylpyrrolidin-2-yl]methylimino]-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile.
| Compound Name | 3-[[(2R)-1-ethylpyrrolidin-2-yl]methylimino]-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
|---|---|
| PubChem CID | 8811959 |
| Molecular Formula | C14H20N4S |
| Molecular Weight | 276.41 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 3-[[(2R)-1-ethylpyrrolidin-2-yl]methylimino]-2-(4-methyl-1,3-thiazol-2-yl)propanenitrile |
| SMILES | CCN1CCC[C@@H]1C/N=C/C(C#N)c1nc(C)cs1 |
| InChI | InChI=1S/C14H20N4S/c1-3-18-6-4-5-13(18)9-16-8-12(7-15)14-17-11(2)10-19-14/h8,10,12-13H,3-6,9H2,1-2H3/b16-8+/t12?,13-/m1/s1 |
| InChIKey | ICMZVTDPCZEIJI-BKSBGLKTSA-N |
| XLogP | 2.61 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|