C13H22N4O3S — CID 8823100
N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylcyclohexanecarbohydrazide (PubChem CID 8823100) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylcyclohexanecarbohydrazide.
| Compound Name | N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylcyclohexanecarbohydrazide |
|---|---|
| PubChem CID | 8823100 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | N'-(1,3,5-trimethylpyrazol-4-yl)sulfonylcyclohexanecarbohydrazide |
| SMILES | Cc1nn(C)c(C)c1S(=O)(=O)NNC(=O)C1CCCCC1 |
| InChI | InChI=1S/C13H22N4O3S/c1-9-12(10(2)17(3)15-9)21(19,20)16-14-13(18)11-7-5-4-6-8-11/h11,16H,4-8H2,1-3H3,(H,14,18) |
| InChIKey | GBZOCGOLAKZXSN-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|