About [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate
[2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate (PubChem CID 882316) has the molecular formula C15H13BrO4
and a molecular weight of 337.17 g/mol. Its IUPAC name is [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate.
Analyze [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate?
The IUPAC name of [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate (CID 882316) is [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate.
What is the SMILES notation for [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate?
The canonical SMILES for [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate is Cc1ccc(C)c(C(=O)COC(=O)c2ccc(Br)o2)c1.
What is the InChIKey of [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate?
The InChIKey is DXZYNYRCAHNTNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13BrO4/c1-9-3-4-10(2)11(7-9)12(17)8-19-15(18)13-5-6-14(16)20-13/h3-7H,8H2,1-2H3.
What are the key properties of [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate?
[2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate has a molecular weight of 337.17 g/mol, XLogP of 3.70, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(2,5-dimethylphenyl)-2-oxoethyl] 5-bromofuran-2-carboxylate is sourced from PubChem (CID 882316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).