C20H23N3O4S — CID 8823361
N-[2-(4-ethoxyphenoxy)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 8823361) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenoxy)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-[2-(4-ethoxyphenoxy)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 8823361 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)phenyl]-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | CCOc1ccc(Oc2ccccc2NS(=O)(=O)c2c(C)nn(C)c2C)cc1 |
| InChI | InChI=1S/C20H23N3O4S/c1-5-26-16-10-12-17(13-11-16)27-19-9-7-6-8-18(19)22-28(24,25)20-14(2)21-23(4)15(20)3/h6-13,22H,5H2,1-4H3 |
| InChIKey | QJRFAFJQYGAURK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |