C12H7FN2O2S — CID 8824237
cyanomethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate (PubChem CID 8824237) has the molecular formula C12H7FN2O2S and a molecular weight of 262.26 g/mol. Its IUPAC name is cyanomethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate.
| Compound Name | cyanomethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 8824237 |
| Molecular Formula | C12H7FN2O2S |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | cyanomethyl 2-(4-fluorophenyl)-1,3-thiazole-4-carboxylate |
| SMILES | N#CCOC(=O)c1csc(-c2ccc(F)cc2)n1 |
| InChI | InChI=1S/C12H7FN2O2S/c13-9-3-1-8(2-4-9)11-15-10(7-18-11)12(16)17-6-5-14/h1-4,7H,6H2 |
| InChIKey | DSOXTDYRCZMQPW-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |