C17H17N2O4S- — CID 8826467
5-[(Z)-N-[[2-(4-ethylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylate (PubChem CID 8826467) has the molecular formula C17H17N2O4S- and a molecular weight of 345.40 g/mol. Its IUPAC name is 5-[(Z)-N-[[2-(4-ethylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylate.
| Compound Name | 5-[(Z)-N-[[2-(4-ethylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 8826467 |
| Molecular Formula | C17H17N2O4S- |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | 5-[(Z)-N-[[2-(4-ethylphenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylate |
| SMILES | CCc1ccc(OCC(=O)N/N=C(/C)c2ccc(C(=O)[O-])s2)cc1 |
| InChI | InChI=1S/C17H18N2O4S/c1-3-12-4-6-13(7-5-12)23-10-16(20)19-18-11(2)14-8-9-15(24-14)17(21)22/h4-9H,3,10H2,1-2H3,(H,19,20)(H,21,22)/p-1/b18-11- |
| InChIKey | LVBZGFIZOVYSEI-WQRHYEAKSA-M |
| XLogP | 1.59 |
| TPSA | 90.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|