C15H13ClN2O4S — CID 8826478
5-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid (PubChem CID 8826478) has the molecular formula C15H13ClN2O4S and a molecular weight of 352.80 g/mol. Its IUPAC name is 5-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 8826478 |
| Molecular Formula | C15H13ClN2O4S |
| Molecular Weight | 352.80 g/mol |
| Exact Mass | 352.03 |
| IUPAC Name | 5-[(Z)-N-[[2-(4-chlorophenoxy)acetyl]amino]-C-methylcarbonimidoyl]thiophene-2-carboxylic acid |
| SMILES | C/C(=N/NC(=O)COc1ccc(Cl)cc1)c1ccc(C(=O)O)s1 |
| InChI | InChI=1S/C15H13ClN2O4S/c1-9(12-6-7-13(23-12)15(20)21)17-18-14(19)8-22-11-4-2-10(16)3-5-11/h2-7H,8H2,1H3,(H,18,19)(H,20,21)/b17-9- |
| InChIKey | XDVWOCRDJDXPDB-MFOYZWKCSA-N |
| XLogP | 3.02 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.80 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|