C16H19N2O2+ — CID 8827181
1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone (PubChem CID 8827181) has the molecular formula C16H19N2O2+ and a molecular weight of 271.34 g/mol. Its IUPAC name is 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone.
| Compound Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone |
|---|---|
| PubChem CID | 8827181 |
| Molecular Formula | C16H19N2O2+ |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-(4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl)-2-(4-methylpyridin-1-ium-1-yl)ethanone |
| SMILES | CC(=O)c1c(C)[nH]c(C(=O)C[n+]2ccc(C)cc2)c1C |
| InChI | InChI=1S/C16H18N2O2/c1-10-5-7-18(8-6-10)9-14(20)16-11(2)15(13(4)19)12(3)17-16/h5-8H,9H2,1-4H3/p+1 |
| InChIKey | NDFDJHQUJGWKRE-UHFFFAOYSA-O |
| XLogP | 2.31 |
| TPSA | 53.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|