C18H22N3O2+ — CID 8827742
(2R)-N-(4-acetamidophenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanamide (PubChem CID 8827742) has the molecular formula C18H22N3O2+ and a molecular weight of 312.39 g/mol. Its IUPAC name is (2R)-N-(4-acetamidophenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanamide.
| Compound Name | (2R)-N-(4-acetamidophenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanamide |
|---|---|
| PubChem CID | 8827742 |
| Molecular Formula | C18H22N3O2+ |
| Molecular Weight | 312.39 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | (2R)-N-(4-acetamidophenyl)-2-(2,3-dimethylpyridin-1-ium-1-yl)propanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)[C@@H](C)[n+]2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C18H21N3O2/c1-12-6-5-11-21(13(12)2)14(3)18(23)20-17-9-7-16(8-10-17)19-15(4)22/h5-11,14H,1-4H3,(H-,19,20,22,23)/p+1/t14-/m1/s1 |
| InChIKey | GKUHUMJCSMONLS-CQSZACIVSA-O |
| XLogP | 2.75 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|