C16H16F3N2O+ — CID 8828200
(2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 8828200) has the molecular formula C16H16F3N2O+ and a molecular weight of 309.31 g/mol. Its IUPAC name is (2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 8828200 |
| Molecular Formula | C16H16F3N2O+ |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | (2R)-2-(2,3-dimethylpyridin-1-ium-1-yl)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1ccc[n+]([C@H](C)C(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C16H15F3N2O/c1-9-5-4-8-21(10(9)2)11(3)16(22)20-13-7-6-12(17)14(18)15(13)19/h4-8,11H,1-3H3/p+1/t11-/m1/s1 |
| InChIKey | HLOHOCWUTULCLC-LLVKDONJSA-O |
| XLogP | 3.21 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|