C15H13F3N3O2+ — CID 8853641
1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]pyridin-1-ium-3-carboxamide (PubChem CID 8853641) has the molecular formula C15H13F3N3O2+ and a molecular weight of 324.28 g/mol. Its IUPAC name is 1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]pyridin-1-ium-3-carboxamide.
| Compound Name | 1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]pyridin-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 8853641 |
| Molecular Formula | C15H13F3N3O2+ |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-[(2R)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl]pyridin-1-ium-3-carboxamide |
| SMILES | C[C@H](C(=O)Nc1ccc(F)c(F)c1F)[n+]1cccc(C(N)=O)c1 |
| InChI | InChI=1S/C15H12F3N3O2/c1-8(21-6-2-3-9(7-21)14(19)22)15(23)20-11-5-4-10(16)12(17)13(11)18/h2-8H,1H3,(H2-,19,20,22,23)/p+1/t8-/m1/s1 |
| InChIKey | ZLMVXFYFJRSYJE-MRVPVSSYSA-O |
| XLogP | 1.69 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|