C17H17F3N2O — CID 30335335
(2S)-2-(2,3-dimethylanilino)-N-(2,3,4-trifluorophenyl)propanamide (PubChem CID 30335335) has the molecular formula C17H17F3N2O and a molecular weight of 322.33 g/mol. Its IUPAC name is (2S)-2-(2,3-dimethylanilino)-N-(2,3,4-trifluorophenyl)propanamide.
| Compound Name | (2S)-2-(2,3-dimethylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
|---|---|
| PubChem CID | 30335335 |
| Molecular Formula | C17H17F3N2O |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2S)-2-(2,3-dimethylanilino)-N-(2,3,4-trifluorophenyl)propanamide |
| SMILES | Cc1cccc(N[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C17H17F3N2O/c1-9-5-4-6-13(10(9)2)21-11(3)17(23)22-14-8-7-12(18)15(19)16(14)20/h4-8,11,21H,1-3H3,(H,22,23)/t11-/m0/s1 |
| InChIKey | IVWTZLSJHVISDT-NSHDSACASA-N |
| XLogP | 4.16 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|