C20H26N3O3S+ — CID 8827974
2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 8827974) has the molecular formula C20H26N3O3S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 8827974 |
| Molecular Formula | C20H26N3O3S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | 2-(2,3-dimethylpyridin-1-ium-1-yl)-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)C[n+]3cccc(C)c3C)CC2)cc1 |
| InChI | InChI=1S/C20H26N3O3S/c1-16-6-8-19(9-7-16)27(25,26)23-13-11-21(12-14-23)20(24)15-22-10-4-5-17(2)18(22)3/h4-10H,11-15H2,1-3H3/q+1 |
| InChIKey | WOGYMXPNSNJLNQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|