C17H13Cl2N2O+ — CID 8829211
N-(3,4-dichlorophenyl)-2-isoquinolin-2-ium-2-ylacetamide (PubChem CID 8829211) has the molecular formula C17H13Cl2N2O+ and a molecular weight of 332.21 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-2-isoquinolin-2-ium-2-ylacetamide.
| Compound Name | N-(3,4-dichlorophenyl)-2-isoquinolin-2-ium-2-ylacetamide |
|---|---|
| PubChem CID | 8829211 |
| Molecular Formula | C17H13Cl2N2O+ |
| Molecular Weight | 332.21 g/mol |
| Exact Mass | 331.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-2-isoquinolin-2-ium-2-ylacetamide |
| SMILES | O=C(C[n+]1ccc2ccccc2c1)Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C17H12Cl2N2O/c18-15-6-5-14(9-16(15)19)20-17(22)11-21-8-7-12-3-1-2-4-13(12)10-21/h1-10H,11H2/p+1 |
| InChIKey | JLCLCRXJLFSSMD-UHFFFAOYSA-O |
| XLogP | 4.07 |
| TPSA | 32.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|