C18H22O3 — CID 8831304
4-[[(3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]benzoic acid (PubChem CID 8831304) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 4-[[(3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]benzoic acid.
| Compound Name | 4-[[(3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]benzoic acid |
|---|---|
| PubChem CID | 8831304 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-[[(3R,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]benzoic acid |
| SMILES | CC(C)[C@H]1CC[C@H](C)C(=Cc2ccc(C(=O)O)cc2)C1=O |
| InChI | InChI=1S/C18H22O3/c1-11(2)15-9-4-12(3)16(17(15)19)10-13-5-7-14(8-6-13)18(20)21/h5-8,10-12,15H,4,9H2,1-3H3,(H,20,21)/t12-,15+/m0/s1 |
| InChIKey | LQDLSAUEAUBYTB-SWLSCSKDSA-N |
| XLogP | 4.04 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|