C20H25NO3 — CID 8831356
2-[2-methoxy-4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenoxy]acetonitrile (PubChem CID 8831356) has the molecular formula C20H25NO3 and a molecular weight of 327.42 g/mol. Its IUPAC name is 2-[2-methoxy-4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenoxy]acetonitrile.
| Compound Name | 2-[2-methoxy-4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenoxy]acetonitrile |
|---|---|
| PubChem CID | 8831356 |
| Molecular Formula | C20H25NO3 |
| Molecular Weight | 327.42 g/mol |
| Exact Mass | 327.18 |
| IUPAC Name | 2-[2-methoxy-4-[[(3S,6S)-6-methyl-2-oxo-3-propan-2-ylcyclohexylidene]methyl]phenoxy]acetonitrile |
| SMILES | COc1cc(C=C2C(=O)[C@H](C(C)C)CC[C@@H]2C)ccc1OCC#N |
| InChI | InChI=1S/C20H25NO3/c1-13(2)16-7-5-14(3)17(20(16)22)11-15-6-8-18(24-10-9-21)19(12-15)23-4/h6,8,11-14,16H,5,7,10H2,1-4H3/t14-,16-/m0/s1 |
| InChIKey | DLFMNFQWVWXVLX-HOCLYGCPSA-N |
| XLogP | 4.25 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.42 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|