C22H27N3O5 — CID 8833628
2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide (PubChem CID 8833628) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is 2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide.
| Compound Name | 2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 8833628 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | 2-[(2R)-2-(2,5-dimethoxyphenyl)pyrrolidin-1-yl]-N-(2,3-dimethyl-6-nitrophenyl)acetamide |
| SMILES | COc1ccc(OC)c([C@H]2CCCN2CC(=O)Nc2c([N+](=O)[O-])ccc(C)c2C)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-14-7-9-19(25(27)28)22(15(14)2)23-21(26)13-24-11-5-6-18(24)17-12-16(29-3)8-10-20(17)30-4/h7-10,12,18H,5-6,11,13H2,1-4H3,(H,23,26)/t18-/m1/s1 |
| InChIKey | HCNNVZDRKVMBTR-GOSISDBHSA-N |
| XLogP | 4.00 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|