C20H24N2O5 — CID 8835295
4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethoxyphenyl)butanamide (PubChem CID 8835295) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is 4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethoxyphenyl)butanamide.
| Compound Name | 4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 8835295 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | 4-[(3aR,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(3,5-dimethoxyphenyl)butanamide |
| SMILES | COc1cc(NC(=O)CCCN2C(=O)[C@@H]3CC=CC[C@H]3C2=O)cc(OC)c1 |
| InChI | InChI=1S/C20H24N2O5/c1-26-14-10-13(11-15(12-14)27-2)21-18(23)8-5-9-22-19(24)16-6-3-4-7-17(16)20(22)25/h3-4,10-12,16-17H,5-9H2,1-2H3,(H,21,23)/t16-,17-/m1/s1 |
| InChIKey | BIXCOIXARSUFJB-IAGOWNOFSA-N |
| XLogP | 2.37 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|