C25H26N2O4 — CID 8835272
4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenylmethoxyphenyl)butanamide (PubChem CID 8835272) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is 4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenylmethoxyphenyl)butanamide.
| Compound Name | 4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenylmethoxyphenyl)butanamide |
|---|---|
| PubChem CID | 8835272 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | 4-[(3aS,7aR)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-(4-phenylmethoxyphenyl)butanamide |
| SMILES | O=C(CCCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)Nc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26N2O4/c28-23(11-6-16-27-24(29)21-9-4-5-10-22(21)25(27)30)26-19-12-14-20(15-13-19)31-17-18-7-2-1-3-8-18/h1-5,7-8,12-15,21-22H,6,9-11,16-17H2,(H,26,28)/t21-,22+ |
| InChIKey | FHYAUOBWHFJZQZ-SZPZYZBQSA-N |
| XLogP | 3.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|