C21H22N4O4 — CID 8835515
4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]butanamide (PubChem CID 8835515) has the molecular formula C21H22N4O4 and a molecular weight of 394.43 g/mol. Its IUPAC name is 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]butanamide.
| Compound Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
|---|---|
| PubChem CID | 8835515 |
| Molecular Formula | C21H22N4O4 |
| Molecular Weight | 394.43 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 4-[(3aR,7aS)-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-2-yl]-N-[(3-phenyl-1,2,4-oxadiazol-5-yl)methyl]butanamide |
| SMILES | O=C(CCCN1C(=O)[C@H]2CC=CC[C@H]2C1=O)NCc1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C21H22N4O4/c26-17(22-13-18-23-19(24-29-18)14-7-2-1-3-8-14)11-6-12-25-20(27)15-9-4-5-10-16(15)21(25)28/h1-5,7-8,15-16H,6,9-13H2,(H,22,26)/t15-,16+ |
| InChIKey | XHOKPZUQGJFSKX-IYBDPMFKSA-N |
| XLogP | 2.08 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|